| General Information | |
|---|---|
| ZINC ID | ZINC000027711059 |
| Molecular Weight (Da) | 516 |
| SMILES | COc1ccc(-c2c(C)c(C(=O)NCCN3CCC[C@H]3CCN)nn2-c2ccc(Cl)cc2Cl)cc1 |
| Molecular Formula | C26Cl2N5O2 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 141.924 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| LogP | 4.83 |
| Activity (Ki) in nM | 380.189 |
| Polar Surface Area (PSA) | 85.41 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.95925718 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.38 |
| Ilogp | 4.86 |
| Xlogp3 | 4.76 |
| Wlogp | 4.33 |
| Mlogp | 3.26 |
| Silicos-it log p | 4.72 |
| Consensus log p | 4.39 |
| Esol log s | -5.74 |
| Esol solubility (mg/ml) | 0.000939 |
| Esol solubility (mol/l) | 0.00000182 |
| Esol class | Moderately |
| Ali log s | -6.28 |
| Ali solubility (mg/ml) | 0.000268 |
| Ali solubility (mol/l) | 0.00000052 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.47 |
| Silicos-it solubility (mg/ml) | 0.00000175 |
| Silicos-it solubility (mol/l) | 3.40E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.07 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 4.22 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.337 |
| Logd | 3.564 |
| Logp | 4.136 |
| F (20%) | 0.002 |
| F (30%) | 0.004 |
| Mdck | - |
| Ppb | 92.67% |
| Vdss | 2.315 |
| Fu | 8.24% |
| Cyp1a2-inh | 0.207 |
| Cyp1a2-sub | 0.939 |
| Cyp2c19-inh | 0.493 |
| Cyp2c19-sub | 0.847 |
| Cl | 7.859 |
| T12 | 0.046 |
| H-ht | 0.475 |
| Dili | 0.909 |
| Roa | 0.295 |
| Fdamdd | 0.345 |
| Skinsen | 0.297 |
| Ec | 0.003 |
| Ei | 0.007 |
| Respiratory | 0.623 |
| Bcf | 2.016 |
| Igc50 | 4.672 |
| Lc50 | 5.776 |
| Lc50dm | 6.3 |
| Nr-ar | 0.036 |
| Nr-ar-lbd | 0.014 |
| Nr-ahr | 0.879 |
| Nr-aromatase | 0.894 |
| Nr-er | 0.452 |
| Nr-er-lbd | 0.018 |
| Nr-ppar-gamma | 0.015 |
| Sr-are | 0.81 |
| Sr-atad5 | 0.041 |
| Sr-hse | 0.015 |
| Sr-mmp | 0.348 |
| Sr-p53 | 0.85 |
| Vol | 503.285 |
| Dense | 1.024 |
| Flex | 0.435 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.431 |
| Synth | 3.011 |
| Fsp3 | 0.385 |
| Mce-18 | 77.333 |
| Natural product-likeness | -1.247 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |