| General Information | |
|---|---|
| ZINC ID | ZINC000014975675 |
| Molecular Weight (Da) | 494 |
| SMILES | Cc1c(C(=O)NCc2ccc(Cl)c(Cl)c2)nn(-c2ccc(Cl)cc2Cl)c1-n1cccc1 |
| Molecular Formula | C22Cl4N4O1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 124.315 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| LogP | 6.648 |
| Activity (Ki) in nM | 37.1535 |
| Polar Surface Area (PSA) | 51.85 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.936 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 22 |
| Fraction csp3 | 0.09 |
| Ilogp | 4.61 |
| Xlogp3 | 6.61 |
| Wlogp | 6.36 |
| Mlogp | 5.24 |
| Silicos-it log p | 5.58 |
| Consensus log p | 5.68 |
| Esol log s | -7.2 |
| Esol solubility (mg/ml) | 0.0000314 |
| Esol solubility (mol/l) | 6.35E-08 |
| Esol class | Poorly sol |
| Ali log s | -7.5 |
| Ali solubility (mg/ml) | 0.0000157 |
| Ali solubility (mol/l) | 3.17E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.43 |
| Silicos-it solubility (mg/ml) | 0.00000018 |
| Silicos-it solubility (mol/l) | 3.71E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.62 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.13 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.053 |
| Logd | 3.968 |
| Logp | 6.05 |
| F (20%) | 0.001 |
| F (30%) | 0.004 |
| Mdck | - |
| Ppb | 99.89% |
| Vdss | 0.452 |
| Fu | 1.45% |
| Cyp1a2-inh | 0.621 |
| Cyp1a2-sub | 0.693 |
| Cyp2c19-inh | 0.938 |
| Cyp2c19-sub | 0.227 |
| Cl | 3.027 |
| T12 | 0.111 |
| H-ht | 0.214 |
| Dili | 0.967 |
| Roa | 0.222 |
| Fdamdd | 0.834 |
| Skinsen | 0.097 |
| Ec | 0.003 |
| Ei | 0.008 |
| Respiratory | 0.01 |
| Bcf | 3.297 |
| Igc50 | 5.018 |
| Lc50 | 5.952 |
| Lc50dm | 5.434 |
| Nr-ar | 0.039 |
| Nr-ar-lbd | 0.015 |
| Nr-ahr | 0.918 |
| Nr-aromatase | 0.966 |
| Nr-er | 0.541 |
| Nr-er-lbd | 0.02 |
| Nr-ppar-gamma | 0.456 |
| Sr-are | 0.915 |
| Sr-atad5 | 0.546 |
| Sr-hse | 0.301 |
| Sr-mmp | 0.918 |
| Sr-p53 | 0.909 |
| Vol | 439.463 |
| Dense | 1.12 |
| Flex | 0.261 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.344 |
| Synth | 2.528 |
| Fsp3 | 0.091 |
| Mce-18 | 24 |
| Natural product-likeness | -1.908 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |