| General Information | |
|---|---|
| ZINC ID | ZINC000013797953 |
| Molecular Weight (Da) | 375 |
| SMILES | CCCCC/C=CC/C=CC/C=CC/C=CCCCNC(=O)NCC(C)C |
| Molecular Formula | C24N2O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 124.035 |
| HBA | 1 |
| HBD | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| LogP | 7.344 |
| Activity (Ki) in nM | 338.844 |
| Polar Surface Area (PSA) | 41.13 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | - |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 1.07927572 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 0 |
| Fraction csp3 | 0.62 |
| Ilogp | 4.86 |
| Xlogp3 | 8.44 |
| Wlogp | 6.7 |
| Mlogp | 5.05 |
| Silicos-it log p | 6.12 |
| Consensus log p | 6.32 |
| Esol log s | -7.35 |
| Esol solubility (mg/ml) | 0.000019 |
| Esol solubility (mol/l) | 4.45E-08 |
| Esol class | Poorly sol |
| Ali log s | -9.37 |
| Ali solubility (mg/ml) | 0.00000018 |
| Ali solubility (mol/l) | 4.30E-10 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.09 |
| Silicos-it solubility (mg/ml) | 0.00000348 |
| Silicos-it solubility (mol/l) | 8.17E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -2.91 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 5.01 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -2.482 |
| Logd | 4.035 |
| Logp | 3.257 |
| F (20%) | 1 |
| F (30%) | 1 |
| Mdck | - |
| Ppb | 99.14% |
| Vdss | 1.898 |
| Fu | 1.81% |
| Cyp1a2-inh | 0.175 |
| Cyp1a2-sub | 0.898 |
| Cyp2c19-inh | 0.653 |
| Cyp2c19-sub | 0.849 |
| Cl | 4.095 |
| T12 | 0.924 |
| H-ht | 0.176 |
| Dili | 0.009 |
| Roa | 0.003 |
| Fdamdd | 0.194 |
| Skinsen | 0.929 |
| Ec | 0.003 |
| Ei | 0.019 |
| Respiratory | 0.884 |
| Bcf | 1.519 |
| Igc50 | 5.221 |
| Lc50 | 3.102 |
| Lc50dm | 4.202 |
| Nr-ar | 0 |
| Nr-ar-lbd | 0.001 |
| Nr-ahr | 0.004 |
| Nr-aromatase | 0.009 |
| Nr-er | 0.083 |
| Nr-er-lbd | 0.005 |
| Nr-ppar-gamma | 0.463 |
| Sr-are | 0.594 |
| Sr-atad5 | 0.003 |
| Sr-hse | 0.875 |
| Sr-mmp | 0.454 |
| Sr-p53 | 0.008 |
| Vol | 441.262 |
| Dense | 0.848 |
| Flex | 3.6 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.229 |
| Synth | 2.853 |
| Fsp3 | 0.625 |
| Mce-18 | 0 |
| Natural product-likeness | 0.177 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Accepted |
| Goldentriangle | Accepted |