| General Information | |
|---|---|
| ZINC ID | ZINC000013797945 |
| Molecular Weight (Da) | 333 |
| SMILES | CCCCC/C=CC/C=CC/C=CC/C=CCCCNC(=O)NC |
| Molecular Formula | C21N2O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 110.291 |
| HBA | 1 |
| HBD | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| LogP | 6.152 |
| Activity (Ki) in nM | 436.516 |
| Polar Surface Area (PSA) | 41.13 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | - |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 1.01609706 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 0 |
| Fraction csp3 | 0.57 |
| Ilogp | 4.06 |
| Xlogp3 | 5.59 |
| Wlogp | 5.67 |
| Mlogp | 3.75 |
| Silicos-it log p | 6.29 |
| Consensus log p | 4.88 |
| Esol log s | -6.14 |
| Esol solubility (mg/ml) | 0.000318 |
| Esol solubility (mol/l) | 0.00000072 |
| Esol class | Poorly sol |
| Ali log s | -7.01 |
| Ali solubility (mg/ml) | 0.0000432 |
| Ali solubility (mol/l) | 9.79E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.67 |
| Silicos-it solubility (mg/ml) | 0.00000933 |
| Silicos-it solubility (mol/l) | 2.11E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.02 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 2 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.16 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -2.621 |
| Logd | 2.792 |
| Logp | 1.942 |
| F (20%) | 1 |
| F (30%) | 1 |
| Mdck | - |
| Ppb | 98.43% |
| Vdss | 1.073 |
| Fu | 1.54% |
| Cyp1a2-inh | 0.282 |
| Cyp1a2-sub | 0.94 |
| Cyp2c19-inh | 0.73 |
| Cyp2c19-sub | 0.821 |
| Cl | 4.101 |
| T12 | 0.934 |
| H-ht | 0.172 |
| Dili | 0.009 |
| Roa | 0.003 |
| Fdamdd | 0.257 |
| Skinsen | 0.93 |
| Ec | 0.003 |
| Ei | 0.015 |
| Respiratory | 0.875 |
| Bcf | 1.13 |
| Igc50 | 5.064 |
| Lc50 | 3.145 |
| Lc50dm | 4.063 |
| Nr-ar | 0 |
| Nr-ar-lbd | 0.002 |
| Nr-ahr | 0.005 |
| Nr-aromatase | 0.011 |
| Nr-er | 0.086 |
| Nr-er-lbd | 0.004 |
| Nr-ppar-gamma | 0.535 |
| Sr-are | 0.618 |
| Sr-atad5 | 0.007 |
| Sr-hse | 0.806 |
| Sr-mmp | 0.414 |
| Sr-p53 | 0.007 |
| Vol | 389.374 |
| Dense | 0.853 |
| Flex | 3.2 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.312 |
| Synth | 2.888 |
| Fsp3 | 0.571 |
| Mce-18 | 0 |
| Natural product-likeness | 0.296 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Accepted |
| Goldentriangle | Accepted |