| General Information | |
|---|---|
| ZINC ID | ZINC000013782507 |
| Molecular Weight (Da) | 344 |
| SMILES | C=CCNC(=O)CCC/C=CC/C=CC/C=CC/C=CCCCCC |
| Molecular Formula | C23N1O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 115.836 |
| HBA | 1 |
| HBD | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| LogP | 6.634 |
| Activity (Ki) in nM | 10 |
| Polar Surface Area (PSA) | 29.1 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | - |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 0.951 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 0 |
| Fraction csp3 | 0.52 |
| Ilogp | 3.8 |
| Xlogp3 | 5.15 |
| Wlogp | 6.43 |
| Mlogp | 3.14 |
| Silicos-it log p | 5.24 |
| Consensus log p | 4.39 |
| Esol log s | -5.82 |
| Esol solubility (mg/ml) | 0.000633 |
| Esol solubility (mol/l) | 0.00000151 |
| Esol class | Moderately |
| Ali log s | -5.62 |
| Ali solubility (mg/ml) | 0.00101 |
| Ali solubility (mol/l) | 0.0000024 |
| Ali class | Moderately |
| Silicos-it logsw | -8.12 |
| Silicos-it solubility (mg/ml) | 0.00000321 |
| Silicos-it solubility (mol/l) | 7.66E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.2 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.01 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -2.807 |
| Logd | 3.145 |
| Logp | 2.619 |
| F (20%) | 1 |
| F (30%) | 1 |
| Mdck | - |
| Ppb | 99.84% |
| Vdss | 1.492 |
| Fu | 0.73% |
| Cyp1a2-inh | 0.258 |
| Cyp1a2-sub | 0.91 |
| Cyp2c19-inh | 0.56 |
| Cyp2c19-sub | 0.229 |
| Cl | 3.968 |
| T12 | 0.945 |
| H-ht | 0.089 |
| Dili | 0.006 |
| Roa | 0.002 |
| Fdamdd | 0.148 |
| Skinsen | 0.969 |
| Ec | 0.005 |
| Ei | 0.076 |
| Respiratory | 0.904 |
| Bcf | 1.405 |
| Igc50 | 4.958 |
| Lc50 | 3.057 |
| Lc50dm | 4.265 |
| Nr-ar | 0.001 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.005 |
| Nr-aromatase | 0.018 |
| Nr-er | 0.1 |
| Nr-er-lbd | 0.008 |
| Nr-ppar-gamma | 0.794 |
| Sr-are | 0.707 |
| Sr-atad5 | 0.006 |
| Sr-hse | 0.938 |
| Sr-mmp | 0.307 |
| Sr-p53 | 0.165 |
| Vol | 410.332 |
| Dense | 0.837 |
| Flex | 2.833 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.254 |
| Synth | 2.905 |
| Fsp3 | 0.522 |
| Mce-18 | 0 |
| Natural product-likeness | 0.348 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Accepted |
| Goldentriangle | Accepted |