| General Information | |
|---|---|
| ZINC ID | ZINC000013766084 |
| Molecular Weight (Da) | 390 |
| SMILES | CCCCC[C@H](C)C/C=CC/C=CC/C=CC/C=CCCCC(=O)NCCO |
| Molecular Formula | C25N1O2 |
| Action | Partial Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 126.716 |
| HBA | 2 |
| HBD | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| LogP | 6.643 |
| Activity (Ki) in nM | 10.9648 |
| Polar Surface Area (PSA) | 49.33 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 0.788 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 0 |
| Fraction csp3 | 0.64 |
| Ilogp | 4.13 |
| Xlogp3 | 4.96 |
| Wlogp | 6.27 |
| Mlogp | 3.07 |
| Silicos-it log p | 5.65 |
| Consensus log p | 4.48 |
| Esol log s | -5.65 |
| Esol solubility (mg/ml) | 0.000932 |
| Esol solubility (mol/l) | 0.00000226 |
| Esol class | Moderately |
| Ali log s | -5.42 |
| Ali solubility (mg/ml) | 0.00156 |
| Ali solubility (mol/l) | 0.00000378 |
| Ali class | Moderately |
| Silicos-it logsw | -8.28 |
| Silicos-it solubility (mg/ml) | 0.00000216 |
| Silicos-it solubility (mol/l) | 5.25E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.29 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.2 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -2.903 |
| Logd | 3.26 |
| Logp | 2.603 |
| F (20%) | 1 |
| F (30%) | 1 |
| Mdck | - |
| Ppb | 98.08% |
| Vdss | 1.43 |
| Fu | 1.72% |
| Cyp1a2-inh | 0.225 |
| Cyp1a2-sub | 0.721 |
| Cyp2c19-inh | 0.442 |
| Cyp2c19-sub | 0.092 |
| Cl | 4.332 |
| T12 | 0.95 |
| H-ht | 0.155 |
| Dili | 0.01 |
| Roa | 0.002 |
| Fdamdd | 0.178 |
| Skinsen | 0.967 |
| Ec | 0.003 |
| Ei | 0.033 |
| Respiratory | 0.919 |
| Bcf | 1.128 |
| Igc50 | 4.904 |
| Lc50 | 2.525 |
| Lc50dm | 3.949 |
| Nr-ar | 0 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.003 |
| Nr-aromatase | 0.018 |
| Nr-er | 0.094 |
| Nr-er-lbd | 0.008 |
| Nr-ppar-gamma | 0.839 |
| Sr-are | 0.753 |
| Sr-atad5 | 0.005 |
| Sr-hse | 0.924 |
| Sr-mmp | 0.359 |
| Sr-p53 | 0.616 |
| Vol | 456.351 |
| Dense | 0.853 |
| Flex | 3.8 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.214 |
| Synth | 3.382 |
| Fsp3 | 0.64 |
| Mce-18 | 2 |
| Natural product-likeness | 0.951 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Accepted |
| Goldentriangle | Accepted |