| General Information | |
|---|---|
| ZINC ID | ZINC000013761121 |
| Molecular Weight (Da) | 390 |
| SMILES | CCCCC/C=CC/C=CC/C=CC/C=CCCC(C)(C)C(=O)NC[C@@H](C)O |
| Molecular Formula | C25N1O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 126.459 |
| HBA | 2 |
| HBD | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| LogP | 6.735 |
| Activity (Ki) in nM | 154.882 |
| Polar Surface Area (PSA) | 49.33 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | - |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 0.86888539 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 0 |
| Fraction csp3 | 0.64 |
| Ilogp | 3.94 |
| Xlogp3 | 5.09 |
| Wlogp | 6.27 |
| Mlogp | 3.85 |
| Silicos-it log p | 5.2 |
| Consensus log p | 4.6 |
| Esol log s | -5.75 |
| Esol solubility (mg/ml) | 0.000773 |
| Esol solubility (mol/l) | 0.00000176 |
| Esol class | Moderately |
| Ali log s | -6.24 |
| Ali solubility (mg/ml) | 0.000251 |
| Ali solubility (mol/l) | 0.00000057 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.21 |
| Silicos-it solubility (mg/ml) | 0.00000274 |
| Silicos-it solubility (mol/l) | 6.24E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.36 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.08 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -2.907 |
| Logd | 2.65 |
| Logp | 2.725 |
| F (20%) | 1 |
| F (30%) | 1 |
| Mdck | - |
| Ppb | 98.79% |
| Vdss | 2.044 |
| Fu | 1.36% |
| Cyp1a2-inh | 0.132 |
| Cyp1a2-sub | 0.934 |
| Cyp2c19-inh | 0.547 |
| Cyp2c19-sub | 0.86 |
| Cl | 3.49 |
| T12 | 0.911 |
| H-ht | 0.112 |
| Dili | 0.003 |
| Roa | 0.004 |
| Fdamdd | 0.52 |
| Skinsen | 0.934 |
| Ec | 0.003 |
| Ei | 0.018 |
| Respiratory | 0.845 |
| Bcf | 1.201 |
| Igc50 | 4.933 |
| Lc50 | 3.384 |
| Lc50dm | 4.202 |
| Nr-ar | 0 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.002 |
| Nr-aromatase | 0.011 |
| Nr-er | 0.058 |
| Nr-er-lbd | 0.01 |
| Nr-ppar-gamma | 0.674 |
| Sr-are | 0.612 |
| Sr-atad5 | 0.003 |
| Sr-hse | 0.922 |
| Sr-mmp | 0.498 |
| Sr-p53 | 0.009 |
| Vol | 456.351 |
| Dense | 0.853 |
| Flex | 3.4 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.241 |
| Synth | 3.556 |
| Fsp3 | 0.64 |
| Mce-18 | 5 |
| Natural product-likeness | 0.586 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Accepted |
| Goldentriangle | Accepted |