| General Information | |
|---|---|
| ZINC ID | ZINC000013761112 |
| Molecular Weight (Da) | 374 |
| SMILES | CCCCC/C=CC/C=CC/C=CC/C=CCCC(C)(C)C(=O)NC(C)C |
| Molecular Formula | C25N1O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 124.915 |
| HBA | 1 |
| HBD | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| LogP | 7.623 |
| Activity (Ki) in nM | 7.2444 |
| Polar Surface Area (PSA) | 29.1 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | - |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 1.336 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 0 |
| Fraction csp3 | 0.64 |
| Ilogp | 5.24 |
| Xlogp3 | 7.63 |
| Wlogp | 7.29 |
| Mlogp | 5.56 |
| Silicos-it log p | 5.82 |
| Consensus log p | 6.31 |
| Esol log s | -8.4 |
| Esol solubility (mg/ml) | 0.00000245 |
| Esol solubility (mol/l) | 3.98E-09 |
| Esol class | Poorly sol |
| Ali log s | -9.26 |
| Ali solubility (mg/ml) | 0.00000034 |
| Ali solubility (mol/l) | 5.53E-10 |
| Ali class | Poorly sol |
| Silicos-it logsw | -11.46 |
| Silicos-it solubility (mg/ml) | 2.11E-09 |
| Silicos-it solubility (mol/l) | 3.43E-12 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.64 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 4 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 2 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 4.09 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -2.741 |
| Logd | 4.054 |
| Logp | 3.694 |
| F (20%) | 1 |
| F (30%) | 1 |
| Mdck | - |
| Ppb | 99.91% |
| Vdss | 3.022 |
| Fu | 1.26% |
| Cyp1a2-inh | 0.131 |
| Cyp1a2-sub | 0.943 |
| Cyp2c19-inh | 0.547 |
| Cyp2c19-sub | 0.898 |
| Cl | 3.715 |
| T12 | 0.905 |
| H-ht | 0.232 |
| Dili | 0.004 |
| Roa | 0.003 |
| Fdamdd | 0.203 |
| Skinsen | 0.945 |
| Ec | 0.003 |
| Ei | 0.022 |
| Respiratory | 0.885 |
| Bcf | 1.562 |
| Igc50 | 5.058 |
| Lc50 | 3.385 |
| Lc50dm | 4.526 |
| Nr-ar | 0 |
| Nr-ar-lbd | 0.002 |
| Nr-ahr | 0.002 |
| Nr-aromatase | 0.012 |
| Nr-er | 0.106 |
| Nr-er-lbd | 0.019 |
| Nr-ppar-gamma | 0.188 |
| Sr-are | 0.605 |
| Sr-atad5 | 0.002 |
| Sr-hse | 0.925 |
| Sr-mmp | 0.49 |
| Sr-p53 | 0.001 |
| Vol | 447.561 |
| Dense | 0.834 |
| Flex | 3.2 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.237 |
| Synth | 3.069 |
| Fsp3 | 0.64 |
| Mce-18 | 0 |
| Natural product-likeness | 0.5 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Accepted |
| Goldentriangle | Accepted |