| General Information | |
|---|---|
| ZINC ID | ZINC000013761106 |
| Molecular Weight (Da) | 360 |
| SMILES | CCCCC/C=CC/C=CC/C=CC/C=CCCCC(=O)NCCCC |
| Molecular Formula | C24N1O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 120.546 |
| HBA | 1 |
| HBD | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| LogP | 7.346 |
| Activity (Ki) in nM | 30.1995 |
| Polar Surface Area (PSA) | 29.1 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | - |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 0.885 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 0 |
| Fraction csp3 | 0.62 |
| Ilogp | 7.84 |
| Xlogp3 | 12.31 |
| Wlogp | 7.05 |
| Mlogp | 7.42 |
| Silicos-it log p | 12.12 |
| Consensus log p | 10.34 |
| Esol log s | -12.37 |
| Esol solubility (mg/ml) | 3.88E-10 |
| Esol solubility (mol/l) | 4.25E-13 |
| Esol class | Insoluble |
| Ali log s | -14.55 |
| Ali solubility (mg/ml) | 2.59E-12 |
| Ali solubility (mol/l) | 2.83E-15 |
| Ali class | Insoluble |
| Silicos-it logsw | -18.79 |
| Silicos-it solubility (mg/ml) | 1.49E-16 |
| Silicos-it solubility (mol/l) | 1.63E-19 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.14 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 4 |
| Veber number of violations | 1 |
| Egan number of violations | 1 |
| Muegge number of violations | 3 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 5.28 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -2.686 |
| Logd | 3.824 |
| Logp | 3.265 |
| F (20%) | 1 |
| F (30%) | 1 |
| Mdck | - |
| Ppb | 99.35% |
| Vdss | 2.776 |
| Fu | 1.12% |
| Cyp1a2-inh | 0.203 |
| Cyp1a2-sub | 0.894 |
| Cyp2c19-inh | 0.482 |
| Cyp2c19-sub | 0.254 |
| Cl | 4.073 |
| T12 | 0.932 |
| H-ht | 0.146 |
| Dili | 0.019 |
| Roa | 0.004 |
| Fdamdd | 0.173 |
| Skinsen | 0.966 |
| Ec | 0.004 |
| Ei | 0.07 |
| Respiratory | 0.882 |
| Bcf | 1.167 |
| Igc50 | 5.214 |
| Lc50 | 2.514 |
| Lc50dm | 4.32 |
| Nr-ar | 0 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.002 |
| Nr-aromatase | 0.03 |
| Nr-er | 0.132 |
| Nr-er-lbd | 0.008 |
| Nr-ppar-gamma | 0.761 |
| Sr-are | 0.671 |
| Sr-atad5 | 0.005 |
| Sr-hse | 0.942 |
| Sr-mmp | 0.382 |
| Sr-p53 | 0.154 |
| Vol | 430.265 |
| Dense | 0.835 |
| Flex | 3.6 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.219 |
| Synth | 2.732 |
| Fsp3 | 0.625 |
| Mce-18 | 0 |
| Natural product-likeness | 0.389 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Accepted |
| Goldentriangle | Accepted |