| General Information | |
|---|---|
| ZINC ID | ZINC000013755922 |
| Molecular Weight (Da) | 442 |
| SMILES | O=C(c1cccc2cc(N=C=S)ccc12)c1cn(CCN2CCOCC2)c2ccccc12 |
| Molecular Formula | C26N3O2S1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 129.09 |
| HBA | 3 |
| HBD | 0 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| LogP | 5 |
| Activity (Ki) in nM | 524.807 |
| Polar Surface Area (PSA) | 78.92 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.97008705 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 19 |
| Fraction csp3 | 0.23 |
| Ilogp | 4.2 |
| Xlogp3 | 5.59 |
| Wlogp | 4.71 |
| Mlogp | 3.75 |
| Silicos-it log p | 6.29 |
| Consensus log p | 4.91 |
| Esol log s | -6.14 |
| Esol solubility (mg/ml) | 0.000318 |
| Esol solubility (mol/l) | 0.00000072 |
| Esol class | Poorly sol |
| Ali log s | -7.01 |
| Ali solubility (mg/ml) | 0.0000432 |
| Ali solubility (mol/l) | 9.79E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.67 |
| Silicos-it solubility (mg/ml) | 0.00000933 |
| Silicos-it solubility (mol/l) | 2.11E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.02 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 2 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.15 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.583 |
| Logd | 4.296 |
| Logp | 5.43 |
| F (20%) | 0.003 |
| F (30%) | 0.004 |
| Mdck | - |
| Ppb | 96.62% |
| Vdss | 2.305 |
| Fu | 2.09% |
| Cyp1a2-inh | 0.399 |
| Cyp1a2-sub | 0.713 |
| Cyp2c19-inh | 0.382 |
| Cyp2c19-sub | 0.126 |
| Cl | 4.867 |
| T12 | 0.013 |
| H-ht | 0.658 |
| Dili | 0.977 |
| Roa | 0.698 |
| Fdamdd | 0.327 |
| Skinsen | 0.685 |
| Ec | 0.003 |
| Ei | 0.02 |
| Respiratory | 0.494 |
| Bcf | 1.52 |
| Igc50 | 5.526 |
| Lc50 | 6.585 |
| Lc50dm | 6.427 |
| Nr-ar | 0.003 |
| Nr-ar-lbd | 0.097 |
| Nr-ahr | 0.962 |
| Nr-aromatase | 0.947 |
| Nr-er | 0.637 |
| Nr-er-lbd | 0.608 |
| Nr-ppar-gamma | 0.941 |
| Sr-are | 0.943 |
| Sr-atad5 | 0.417 |
| Sr-hse | 0.953 |
| Sr-mmp | 0.948 |
| Sr-p53 | 0.945 |
| Vol | 452.912 |
| Dense | 0.974 |
| Flex | 0.2 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 2 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 6 |
| Surechembl | 3 |
| Nonbiodegradable | 1 |
| Skin sensitization | 4 |
| Acute aquatic toxicity | - |
| Toxicophores | 6 |
| Qed | 0.238 |
| Synth | 2.658 |
| Fsp3 | 0.231 |
| Mce-18 | 56.25 |
| Natural product-likeness | -1.313 |
| Alarm nmr | 1 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |