| General Information | |
|---|---|
| ZINC ID | ZINC000013742582 |
| Molecular Weight (Da) | 413 |
| SMILES | Cc1ccc(C(=O)c2c(C)n(CCN3CCOCC3)c3ccccc23)c2ccccc12 |
| Molecular Formula | C27N2O2 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 123.982 |
| HBA | 2 |
| HBD | 0 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| LogP | 5.01 |
| Activity (Ki) in nM | 5.8884 |
| Polar Surface Area (PSA) | 34.47 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.011 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 19 |
| Fraction csp3 | 0.3 |
| Ilogp | 3.99 |
| Xlogp3 | 4.96 |
| Wlogp | 4.59 |
| Mlogp | 3.07 |
| Silicos-it log p | 5.65 |
| Consensus log p | 4.45 |
| Esol log s | -5.65 |
| Esol solubility (mg/ml) | 0.000932 |
| Esol solubility (mol/l) | 0.00000226 |
| Esol class | Moderately |
| Ali log s | -5.42 |
| Ali solubility (mg/ml) | 0.00156 |
| Ali solubility (mol/l) | 0.00000378 |
| Ali class | Moderately |
| Silicos-it logsw | -8.28 |
| Silicos-it solubility (mg/ml) | 0.00000216 |
| Silicos-it solubility (mol/l) | 5.25E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.29 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.16 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.615 |
| Logd | 4.202 |
| Logp | 5.177 |
| F (20%) | 0.166 |
| F (30%) | 0.918 |
| Mdck | - |
| Ppb | 97.81% |
| Vdss | 2.24 |
| Fu | 0.79% |
| Cyp1a2-inh | 0.599 |
| Cyp1a2-sub | 0.927 |
| Cyp2c19-inh | 0.725 |
| Cyp2c19-sub | 0.187 |
| Cl | 7.964 |
| T12 | 0.005 |
| H-ht | 0.783 |
| Dili | 0.927 |
| Roa | 0.593 |
| Fdamdd | 0.115 |
| Skinsen | 0.156 |
| Ec | 0.003 |
| Ei | 0.036 |
| Respiratory | 0.344 |
| Bcf | 1.931 |
| Igc50 | 4.825 |
| Lc50 | 5.83 |
| Lc50dm | 6.418 |
| Nr-ar | 0.044 |
| Nr-ar-lbd | 0.01 |
| Nr-ahr | 0.807 |
| Nr-aromatase | 0.528 |
| Nr-er | 0.303 |
| Nr-er-lbd | 0.061 |
| Nr-ppar-gamma | 0.005 |
| Sr-are | 0.62 |
| Sr-atad5 | 0.017 |
| Sr-hse | 0.01 |
| Sr-mmp | 0.359 |
| Sr-p53 | 0.588 |
| Vol | 445.975 |
| Dense | 0.924 |
| Flex | 0.179 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 4 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 3 |
| Qed | 0.434 |
| Synth | 2.303 |
| Fsp3 | 0.296 |
| Mce-18 | 57.943 |
| Natural product-likeness | -0.905 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |