| General Information | |
|---|---|
| ZINC ID | ZINC000013680183 |
| Molecular Weight (Da) | 404 |
| SMILES | COc1ccc(N2C(=O)[C@@H](c3ccccc3)N(c3ccc(OC)cc3)C2=S)cc1 |
| Molecular Formula | C23N2O3S1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 116.789 |
| HBA | 3 |
| HBD | 0 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| LogP | 5.61 |
| Activity (Ki) in nM | 7079.46 |
| Polar Surface Area (PSA) | 74.1 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | - |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.01255095 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.13 |
| Ilogp | 3.74 |
| Xlogp3 | 4.67 |
| Wlogp | 3.5 |
| Mlogp | 2.66 |
| Silicos-it log p | 4.35 |
| Consensus log p | 3.78 |
| Esol log s | -5.42 |
| Esol solubility (mg/ml) | 0.00154 |
| Esol solubility (mol/l) | 0.00000381 |
| Esol class | Moderately |
| Ali log s | -5.95 |
| Ali solubility (mg/ml) | 0.00045 |
| Ali solubility (mol/l) | 0.00000111 |
| Ali class | Moderately |
| Silicos-it logsw | -6.86 |
| Silicos-it solubility (mg/ml) | 0.0000561 |
| Silicos-it solubility (mol/l) | 0.00000013 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.45 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.3 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.75 |
| Logd | 4.134 |
| Logp | 3.771 |
| F (20%) | 0.259 |
| F (30%) | 0.015 |
| Mdck | - |
| Ppb | 97.19% |
| Vdss | 0.583 |
| Fu | 2.14% |
| Cyp1a2-inh | 0.539 |
| Cyp1a2-sub | 0.776 |
| Cyp2c19-inh | 0.666 |
| Cyp2c19-sub | 0.26 |
| Cl | 7.507 |
| T12 | 0.707 |
| H-ht | 0.446 |
| Dili | 0.967 |
| Roa | 0.296 |
| Fdamdd | 0.98 |
| Skinsen | 0.175 |
| Ec | 0.003 |
| Ei | 0.019 |
| Respiratory | 0.113 |
| Bcf | 2.707 |
| Igc50 | 5.147 |
| Lc50 | 6.114 |
| Lc50dm | 6.52 |
| Nr-ar | 0.068 |
| Nr-ar-lbd | 0.423 |
| Nr-ahr | 0.351 |
| Nr-aromatase | 0.946 |
| Nr-er | 0.891 |
| Nr-er-lbd | 0.892 |
| Nr-ppar-gamma | 0.667 |
| Sr-are | 0.943 |
| Sr-atad5 | 0.763 |
| Sr-hse | 0.021 |
| Sr-mmp | 0.899 |
| Sr-p53 | 0.841 |
| Vol | 410.01 |
| Dense | 0.986 |
| Flex | 0.208 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 4 |
| Qed | 0.453 |
| Synth | 2.254 |
| Fsp3 | 0.087 |
| Mce-18 | 22 |
| Natural product-likeness | -0.591 |
| Alarm nmr | 3 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |