| General Information | |
|---|---|
| ZINC ID | ZINC000013680140 |
| Molecular Weight (Da) | 486 |
| SMILES | O=C1[C@H](c2ccccc2)N(c2ccc(Br)cc2)C(=O)N1c1ccc(Br)cc1 |
| Molecular Formula | C21Br2N2O2 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 111.117 |
| HBA | 2 |
| HBD | 0 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| LogP | 6.24 |
| Activity (Ki) in nM | 194.984 |
| Polar Surface Area (PSA) | 40.62 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | - |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.0510112 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.05 |
| Ilogp | 3.79 |
| Xlogp3 | 5.51 |
| Wlogp | 4.84 |
| Mlogp | 4.92 |
| Silicos-it log p | 4.14 |
| Consensus log p | 4.64 |
| Esol log s | -6.62 |
| Esol solubility (mg/ml) | 0.000116 |
| Esol solubility (mol/l) | 0.00000023 |
| Esol class | Poorly sol |
| Ali log s | -6.12 |
| Ali solubility (mg/ml) | 0.000367 |
| Ali solubility (mol/l) | 0.00000075 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.02 |
| Silicos-it solubility (mg/ml) | 0.00000462 |
| Silicos-it solubility (mol/l) | 9.51E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.35 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 2.93 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.677 |
| Logd | 4.316 |
| Logp | 5.306 |
| F (20%) | 0.003 |
| F (30%) | 0.004 |
| Mdck | - |
| Ppb | 97.75% |
| Vdss | 0.549 |
| Fu | 2.58% |
| Cyp1a2-inh | 0.439 |
| Cyp1a2-sub | 0.091 |
| Cyp2c19-inh | 0.386 |
| Cyp2c19-sub | 0.117 |
| Cl | 2.346 |
| T12 | 0.568 |
| H-ht | 0.22 |
| Dili | 0.948 |
| Roa | 0.688 |
| Fdamdd | 0.79 |
| Skinsen | 0.262 |
| Ec | 0.003 |
| Ei | 0.16 |
| Respiratory | 0.073 |
| Bcf | 2.332 |
| Igc50 | 5.136 |
| Lc50 | 6.055 |
| Lc50dm | 6.61 |
| Nr-ar | 0.027 |
| Nr-ar-lbd | 0.023 |
| Nr-ahr | 0.669 |
| Nr-aromatase | 0.725 |
| Nr-er | 0.702 |
| Nr-er-lbd | 0.018 |
| Nr-ppar-gamma | 0.023 |
| Sr-are | 0.728 |
| Sr-atad5 | 0.437 |
| Sr-hse | 0.016 |
| Sr-mmp | 0.94 |
| Sr-p53 | 0.626 |
| Vol | 386.686 |
| Dense | 1.252 |
| Flex | 0.125 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.415 |
| Synth | 2.244 |
| Fsp3 | 0 |
| Mce-18 | 22 |
| Natural product-likeness | -0.594 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |