| General Information | |
|---|---|
| ZINC ID | ZINC000013679524 |
| Molecular Weight (Da) | 362 |
| SMILES | CCCCC/C=CC/C=CC/C=CC/C=CCCCCNC(=O)CCO |
| Molecular Formula | C23N1O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 117.72 |
| HBA | 2 |
| HBD | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| LogP | 5.799 |
| Activity (Ki) in nM | 114.815 |
| Polar Surface Area (PSA) | 49.33 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | - |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 0.7465657 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 0 |
| Fraction csp3 | 0.61 |
| Ilogp | 4.99 |
| Xlogp3 | 6.98 |
| Wlogp | 5.63 |
| Mlogp | 4.87 |
| Silicos-it log p | 6.98 |
| Consensus log p | 6.13 |
| Esol log s | -6.98 |
| Esol solubility (mg/ml) | 0.0000537 |
| Esol solubility (mol/l) | 0.0000001 |
| Esol class | Poorly sol |
| Ali log s | -8.33 |
| Ali solubility (mg/ml) | 0.0000024 |
| Ali solubility (mol/l) | 4.72E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -10.37 |
| Silicos-it solubility (mg/ml) | 2.16E-08 |
| Silicos-it solubility (mol/l) | 4.25E-11 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.44 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 1 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.64 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.069 |
| Logd | 2.575 |
| Logp | 1.716 |
| F (20%) | 1 |
| F (30%) | 1 |
| Mdck | - |
| Ppb | 98.16% |
| Vdss | 1.33 |
| Fu | 1.44% |
| Cyp1a2-inh | 0.195 |
| Cyp1a2-sub | 0.875 |
| Cyp2c19-inh | 0.395 |
| Cyp2c19-sub | 0.124 |
| Cl | 4.004 |
| T12 | 0.954 |
| H-ht | 0.151 |
| Dili | 0.01 |
| Roa | 0.002 |
| Fdamdd | 0.111 |
| Skinsen | 0.965 |
| Ec | 0.004 |
| Ei | 0.061 |
| Respiratory | 0.891 |
| Bcf | 1.035 |
| Igc50 | 4.815 |
| Lc50 | 2.72 |
| Lc50dm | 3.783 |
| Nr-ar | 0.001 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.003 |
| Nr-aromatase | 0.036 |
| Nr-er | 0.135 |
| Nr-er-lbd | 0.008 |
| Nr-ppar-gamma | 0.858 |
| Sr-are | 0.707 |
| Sr-atad5 | 0.007 |
| Sr-hse | 0.908 |
| Sr-mmp | 0.241 |
| Sr-p53 | 0.472 |
| Vol | 421.759 |
| Dense | 0.857 |
| Flex | 3.6 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.26 |
| Synth | 2.853 |
| Fsp3 | 0.609 |
| Mce-18 | 0 |
| Natural product-likeness | 0.596 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Accepted |
| Goldentriangle | Accepted |