| General Information | |
|---|---|
| ZINC ID | ZINC000013672806 |
| Molecular Weight (Da) | 413 |
| SMILES | COc1ccc(C(=O)c2cn(C[C@H]3CCCCN3C)c3ccccc23)c2ccccc12 |
| Molecular Formula | C27N2O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 123.242 |
| HBA | 2 |
| HBD | 0 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| LogP | 5.483 |
| Activity (Ki) in nM | 2.2909 |
| Polar Surface Area (PSA) | 34.47 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | + |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.861 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 19 |
| Fraction csp3 | 0.3 |
| Ilogp | 4.09 |
| Xlogp3 | 5.45 |
| Wlogp | 5.14 |
| Mlogp | 3.34 |
| Silicos-it log p | 5.02 |
| Consensus log p | 4.61 |
| Esol log s | -5.95 |
| Esol solubility (mg/ml) | 0.000458 |
| Esol solubility (mol/l) | 0.00000111 |
| Esol class | Moderately |
| Ali log s | -5.93 |
| Ali solubility (mg/ml) | 0.000484 |
| Ali solubility (mol/l) | 0.00000117 |
| Ali class | Moderately |
| Silicos-it logsw | -7.92 |
| Silicos-it solubility (mg/ml) | 0.00000491 |
| Silicos-it solubility (mol/l) | 1.19E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.95 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.41 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.549 |
| Logd | 4.238 |
| Logp | 5.494 |
| F (20%) | 0.088 |
| F (30%) | 0.013 |
| Mdck | - |
| Ppb | 96.77% |
| Vdss | 2.494 |
| Fu | 0.83% |
| Cyp1a2-inh | 0.595 |
| Cyp1a2-sub | 0.968 |
| Cyp2c19-inh | 0.646 |
| Cyp2c19-sub | 0.866 |
| Cl | 6.642 |
| T12 | 0.02 |
| H-ht | 0.929 |
| Dili | 0.939 |
| Roa | 0.373 |
| Fdamdd | 0.394 |
| Skinsen | 0.216 |
| Ec | 0.003 |
| Ei | 0.019 |
| Respiratory | 0.369 |
| Bcf | 1.375 |
| Igc50 | 5.183 |
| Lc50 | 6.082 |
| Lc50dm | 6.709 |
| Nr-ar | 0.23 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.795 |
| Nr-aromatase | 0.267 |
| Nr-er | 0.189 |
| Nr-er-lbd | 0.007 |
| Nr-ppar-gamma | 0.003 |
| Sr-are | 0.42 |
| Sr-atad5 | 0.008 |
| Sr-hse | 0.007 |
| Sr-mmp | 0.606 |
| Sr-p53 | 0.736 |
| Vol | 445.975 |
| Dense | 0.924 |
| Flex | 0.179 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 4 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 3 |
| Qed | 0.405 |
| Synth | 2.786 |
| Fsp3 | 0.296 |
| Mce-18 | 85.429 |
| Natural product-likeness | -0.466 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |