| General Information | |
|---|---|
| ZINC ID | ZINC000013672798 |
| Molecular Weight (Da) | 401 |
| SMILES | CN1CCCC[C@H]1Cn1cc(C(=O)c2ccc(F)c3ccccc23)c2ccccc21 |
| Molecular Formula | C26F1N2O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 116.995 |
| HBA | 1 |
| HBD | 0 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| LogP | 5.705 |
| Activity (Ki) in nM | 0.7079 |
| Polar Surface Area (PSA) | 25.24 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | + |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.895 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 19 |
| Fraction csp3 | 0.27 |
| Ilogp | 4.05 |
| Xlogp3 | 5.58 |
| Wlogp | 5.69 |
| Mlogp | 4.09 |
| Silicos-it log p | 5.38 |
| Consensus log p | 4.96 |
| Esol log s | -6.04 |
| Esol solubility (mg/ml) | 0.000363 |
| Esol solubility (mol/l) | 0.0000009 |
| Esol class | Poorly sol |
| Ali log s | -5.87 |
| Ali solubility (mg/ml) | 0.000538 |
| Ali solubility (mol/l) | 0.00000134 |
| Ali class | Moderately |
| Silicos-it logsw | -8.09 |
| Silicos-it solubility (mg/ml) | 0.00000329 |
| Silicos-it solubility (mol/l) | 8.20E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.78 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.35 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.544 |
| Logd | 4.312 |
| Logp | 5.472 |
| F (20%) | 0.01 |
| F (30%) | 0.015 |
| Mdck | - |
| Ppb | 97.14% |
| Vdss | 3.955 |
| Fu | 0.91% |
| Cyp1a2-inh | 0.666 |
| Cyp1a2-sub | 0.958 |
| Cyp2c19-inh | 0.739 |
| Cyp2c19-sub | 0.757 |
| Cl | 6.466 |
| T12 | 0.005 |
| H-ht | 0.902 |
| Dili | 0.904 |
| Roa | 0.559 |
| Fdamdd | 0.436 |
| Skinsen | 0.12 |
| Ec | 0.003 |
| Ei | 0.03 |
| Respiratory | 0.25 |
| Bcf | 1.534 |
| Igc50 | 5.155 |
| Lc50 | 5.796 |
| Lc50dm | 6.95 |
| Nr-ar | 0.014 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.684 |
| Nr-aromatase | 0.831 |
| Nr-er | 0.319 |
| Nr-er-lbd | 0.024 |
| Nr-ppar-gamma | 0.002 |
| Sr-are | 0.608 |
| Sr-atad5 | 0.014 |
| Sr-hse | 0.014 |
| Sr-mmp | 0.573 |
| Sr-p53 | 0.663 |
| Vol | 425.956 |
| Dense | 0.94 |
| Flex | 0.143 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 3 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 4 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 3 |
| Qed | 0.414 |
| Synth | 2.816 |
| Fsp3 | 0.269 |
| Mce-18 | 85.879 |
| Natural product-likeness | -0.806 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |