| General Information | |
|---|---|
| ZINC ID | ZINC000013650883 |
| Molecular Weight (Da) | 355 |
| SMILES | CC1=CC[C@@H]2[C@@H](C1)c1c(O)cc(CCCCCN=[N+]=[N-])cc1OC2(C)C |
| Molecular Formula | C21N3O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 95.809 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| LogP | 3.875 |
| Activity (Ki) in nM | 19.0546 |
| Polar Surface Area (PSA) | 41.82 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.943 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.62 |
| Ilogp | 4.07 |
| Xlogp3 | 7.41 |
| Wlogp | 6.03 |
| Mlogp | 3.29 |
| Silicos-it log p | 4.04 |
| Consensus log p | 4.97 |
| Esol log s | -6.49 |
| Esol solubility (mg/ml) | 0.000116 |
| Esol solubility (mol/l) | 0.00000032 |
| Esol class | Poorly sol |
| Ali log s | -8.9 |
| Ali solubility (mg/ml) | 0.00000044 |
| Ali solubility (mol/l) | 1.25E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -6.07 |
| Silicos-it solubility (mg/ml) | 0.000305 |
| Silicos-it solubility (mol/l) | 0.00000085 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.21 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 1 |
| Brenk number of alerts | 4 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.28 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -2.995 |
| Logd | 4.763 |
| Logp | 7.196 |
| F (20%) | 0.816 |
| F (30%) | 0.876 |
| Mdck | - |
| Ppb | 100.12% |
| Vdss | 8.583 |
| Fu | 1.82% |
| Cyp1a2-inh | 0.029 |
| Cyp1a2-sub | 0.351 |
| Cyp2c19-inh | 0.245 |
| Cyp2c19-sub | 0.948 |
| Cl | 2.17 |
| T12 | 0.143 |
| H-ht | 0.943 |
| Dili | 0.298 |
| Roa | 0.168 |
| Fdamdd | 0.958 |
| Skinsen | 0.402 |
| Ec | 0.006 |
| Ei | 0.129 |
| Respiratory | 0.974 |
| Bcf | 2.191 |
| Igc50 | 5.008 |
| Lc50 | 6.745 |
| Lc50dm | 5.978 |
| Nr-ar | 0.002 |
| Nr-ar-lbd | 0.005 |
| Nr-ahr | 0.527 |
| Nr-aromatase | 0.005 |
| Nr-er | 0.202 |
| Nr-er-lbd | 0.006 |
| Nr-ppar-gamma | 0.022 |
| Sr-are | 0.941 |
| Sr-atad5 | 0.009 |
| Sr-hse | 0.024 |
| Sr-mmp | 0.774 |
| Sr-p53 | 0.002 |
| Vol | 380.855 |
| Dense | 0.933 |
| Flex | 0.333 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 3 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.222 |
| Synth | 3.817 |
| Fsp3 | 0.619 |
| Mce-18 | 62.588 |
| Natural product-likeness | 2.069 |
| Alarm nmr | 1 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |