| General Information | |
|---|---|
| ZINC ID | ZINC000013611895 |
| Molecular Weight (Da) | 437 |
| SMILES | CCN(CC)C(=O)c1nc(-c2ccc(Cl)cc2Cl)n(-c2ccc(Cl)cc2)c1C |
| Molecular Formula | C21Cl3N3O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 114.178 |
| HBA | 2 |
| HBD | 0 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| LogP | 6.058 |
| Activity (Ki) in nM | 39.8107 |
| Polar Surface Area (PSA) | 38.13 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.146 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.24 |
| Ilogp | 3.94 |
| Xlogp3 | 6.14 |
| Wlogp | 6.29 |
| Mlogp | 4.75 |
| Silicos-it log p | 5.76 |
| Consensus log p | 5.38 |
| Esol log s | -6.47 |
| Esol solubility (mg/ml) | 0.000148 |
| Esol solubility (mol/l) | 0.00000033 |
| Esol class | Poorly sol |
| Ali log s | -6.72 |
| Ali solubility (mg/ml) | 0.0000826 |
| Ali solubility (mol/l) | 0.00000018 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.44 |
| Silicos-it solubility (mg/ml) | 0.0000016 |
| Silicos-it solubility (mol/l) | 3.66E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.6 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.16 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.391 |
| Logd | 4.26 |
| Logp | 5.349 |
| F (20%) | 0.002 |
| F (30%) | 0.002 |
| Mdck | - |
| Ppb | 98.27% |
| Vdss | 0.221 |
| Fu | 2.09% |
| Cyp1a2-inh | 0.875 |
| Cyp1a2-sub | 0.943 |
| Cyp2c19-inh | 0.91 |
| Cyp2c19-sub | 0.275 |
| Cl | 2.581 |
| T12 | 0.104 |
| H-ht | 0.341 |
| Dili | 0.919 |
| Roa | 0.291 |
| Fdamdd | 0.796 |
| Skinsen | 0.024 |
| Ec | 0.003 |
| Ei | 0.019 |
| Respiratory | 0.211 |
| Bcf | 3.449 |
| Igc50 | 4.791 |
| Lc50 | 6.04 |
| Lc50dm | 6.541 |
| Nr-ar | 0.017 |
| Nr-ar-lbd | 0.013 |
| Nr-ahr | 0.831 |
| Nr-aromatase | 0.945 |
| Nr-er | 0.203 |
| Nr-er-lbd | 0.011 |
| Nr-ppar-gamma | 0.007 |
| Sr-are | 0.883 |
| Sr-atad5 | 0.04 |
| Sr-hse | 0.1 |
| Sr-mmp | 0.523 |
| Sr-p53 | 0.78 |
| Vol | 409.788 |
| Dense | 1.062 |
| Flex | 0.333 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.471 |
| Synth | 2.314 |
| Fsp3 | 0.238 |
| Mce-18 | 20 |
| Natural product-likeness | -1.567 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |