| General Information | |
|---|---|
| ZINC ID | ZINC000013611845 |
| Molecular Weight (Da) | 451 |
| SMILES | O=C(NN1CCCCC1)c1nc(-c2ccc(Cl)cc2)n(-c2ccc(Cl)cc2Cl)n1 |
| Molecular Formula | C20Cl3N5O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 118.032 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| LogP | 5.254 |
| Activity (Ki) in nM | 25.1189 |
| Polar Surface Area (PSA) | 63.05 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | + |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.864 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.25 |
| Ilogp | 3.81 |
| Xlogp3 | 5.9 |
| Wlogp | 4.64 |
| Mlogp | 4.52 |
| Silicos-it log p | 3.98 |
| Consensus log p | 4.57 |
| Esol log s | -6.46 |
| Esol solubility (mg/ml) | 0.000158 |
| Esol solubility (mol/l) | 0.00000035 |
| Esol class | Poorly sol |
| Ali log s | -7 |
| Ali solubility (mg/ml) | 0.0000453 |
| Ali solubility (mol/l) | 0.0000001 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.52 |
| Silicos-it solubility (mg/ml) | 0.0000136 |
| Silicos-it solubility (mol/l) | 3.03E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.86 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.29 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.786 |
| Logd | 4.274 |
| Logp | 5.007 |
| F (20%) | 0.001 |
| F (30%) | 0.005 |
| Mdck | - |
| Ppb | 98.67% |
| Vdss | 0.23 |
| Fu | 1.25% |
| Cyp1a2-inh | 0.344 |
| Cyp1a2-sub | 0.85 |
| Cyp2c19-inh | 0.882 |
| Cyp2c19-sub | 0.624 |
| Cl | 2.761 |
| T12 | 0.031 |
| H-ht | 0.602 |
| Dili | 0.967 |
| Roa | 0.659 |
| Fdamdd | 0.554 |
| Skinsen | 0.059 |
| Ec | 0.003 |
| Ei | 0.011 |
| Respiratory | 0.786 |
| Bcf | 1.589 |
| Igc50 | 4.546 |
| Lc50 | 5.413 |
| Lc50dm | 4.967 |
| Nr-ar | 0.009 |
| Nr-ar-lbd | 0.007 |
| Nr-ahr | 0.893 |
| Nr-aromatase | 0.937 |
| Nr-er | 0.823 |
| Nr-er-lbd | 0.02 |
| Nr-ppar-gamma | 0.122 |
| Sr-are | 0.94 |
| Sr-atad5 | 0.407 |
| Sr-hse | 0.206 |
| Sr-mmp | 0.885 |
| Sr-p53 | 0.946 |
| Vol | 405.929 |
| Dense | 1.106 |
| Flex | 0.208 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 2 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.606 |
| Synth | 2.471 |
| Fsp3 | 0.25 |
| Mce-18 | 52.8 |
| Natural product-likeness | -1.664 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |