| General Information | |
|---|---|
| ZINC ID | ZINC000013557667 |
| Molecular Weight (Da) | 369 |
| SMILES | CC1=CC[C@@H]2[C@@H](C1)c1c(O)cc(CC#CCCC[N+](=O)[O-])cc1OC2(C)C |
| Molecular Formula | C22N1O4 |
| Action | Partial Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 100.839 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| LogP | 5.642 |
| Activity (Ki) in nM | 5.3703 |
| Polar Surface Area (PSA) | 72.6 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | -- |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.703 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.55 |
| Ilogp | 3.53 |
| Xlogp3 | 6.09 |
| Wlogp | 4.69 |
| Mlogp | 3.17 |
| Silicos-it log p | 3.2 |
| Consensus log p | 4.13 |
| Esol log s | -5.87 |
| Esol solubility (mg/ml) | 0.000501 |
| Esol solubility (mol/l) | 0.00000136 |
| Esol class | Moderately |
| Ali log s | -7.45 |
| Ali solubility (mg/ml) | 0.0000131 |
| Ali solubility (mol/l) | 3.53E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -4.97 |
| Silicos-it solubility (mg/ml) | 0.00395 |
| Silicos-it solubility (mol/l) | 0.0000107 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.23 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 4 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.49 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.99 |
| Logd | 4.814 |
| Logp | 6.142 |
| F (20%) | 0.951 |
| F (30%) | 0.89 |
| Mdck | - |
| Ppb | 99.03% |
| Vdss | 2.496 |
| Fu | 1.01% |
| Cyp1a2-inh | 0.477 |
| Cyp1a2-sub | 0.539 |
| Cyp2c19-inh | 0.962 |
| Cyp2c19-sub | 0.417 |
| Cl | 6.678 |
| T12 | 0.179 |
| H-ht | 0.942 |
| Dili | 0.153 |
| Roa | 0.082 |
| Fdamdd | 0.932 |
| Skinsen | 0.903 |
| Ec | 0.004 |
| Ei | 0.08 |
| Respiratory | 0.923 |
| Bcf | 2.253 |
| Igc50 | 4.741 |
| Lc50 | 5.96 |
| Lc50dm | 6.242 |
| Nr-ar | 0.05 |
| Nr-ar-lbd | 0.038 |
| Nr-ahr | 0.806 |
| Nr-aromatase | 0.812 |
| Nr-er | 0.297 |
| Nr-er-lbd | 0.055 |
| Nr-ppar-gamma | 0.807 |
| Sr-are | 0.814 |
| Sr-atad5 | 0.027 |
| Sr-hse | 0.308 |
| Sr-mmp | 0.887 |
| Sr-p53 | 0.844 |
| Vol | 391.101 |
| Dense | 0.944 |
| Flex | 0.222 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 5 |
| Qed | 0.277 |
| Synth | 4.117 |
| Fsp3 | 0.545 |
| Mce-18 | 65.882 |
| Natural product-likeness | 2.022 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |