| General Information | |
|---|---|
| ZINC ID | ZINC000013475541 |
| Molecular Weight (Da) | 340 |
| SMILES | CCCCC[C@H](O)/C=C/C=CCCCCCCCC(=O)NCCO |
| Molecular Formula | C20N1O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 103.045 |
| HBA | 3 |
| HBD | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| LogP | 4.353 |
| Activity (Ki) in nM | 602.56 |
| Polar Surface Area (PSA) | 69.56 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 0.8400641 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 0 |
| Fraction csp3 | 0.75 |
| Ilogp | 3.89 |
| Xlogp3 | 4.41 |
| Wlogp | 3.88 |
| Mlogp | 2.79 |
| Silicos-it log p | 5.18 |
| Consensus log p | 4.03 |
| Esol log s | -3.6 |
| Esol solubility (mg/ml) | 8.50E-02 |
| Esol solubility (mol/l) | 2.50E-04 |
| Esol class | Soluble |
| Ali log s | -5.59 |
| Ali solubility (mg/ml) | 8.76E-04 |
| Ali solubility (mol/l) | 2.58E-06 |
| Ali class | Moderately |
| Silicos-it logsw | -4.58 |
| Silicos-it solubility (mg/ml) | 9.01E-03 |
| Silicos-it solubility (mol/l) | 2.65E-05 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.24 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 1 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.85 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.434 |
| Logd | 3.411 |
| Logp | 3.402 |
| F (20%) | 0.999 |
| F (30%) | 0.999 |
| Mdck | 4.12E-05 |
| Ppb | 0.859 |
| Vdss | 0.644 |
| Fu | 0.0923 |
| Cyp1a2-inh | 0.196 |
| Cyp1a2-sub | 0.299 |
| Cyp2c19-inh | 0.336 |
| Cyp2c19-sub | 0.488 |
| Cl | 9.749 |
| T12 | 0.8 |
| H-ht | 0.226 |
| Dili | 0.035 |
| Roa | 0.042 |
| Fdamdd | 0.824 |
| Skinsen | 0.933 |
| Ec | 0.005 |
| Ei | 0.273 |
| Respiratory | 0.796 |
| Bcf | 0.551 |
| Igc50 | 4.472 |
| Lc50 | 4.062 |
| Lc50dm | 4.142 |
| Nr-ar | 0.002 |
| Nr-ar-lbd | 0.001 |
| Nr-ahr | 0.01 |
| Nr-aromatase | 0.006 |
| Nr-er | 0.128 |
| Nr-er-lbd | 0.004 |
| Nr-ppar-gamma | 0.006 |
| Sr-are | 0.615 |
| Sr-atad5 | 0.009 |
| Sr-hse | 0.029 |
| Sr-mmp | 0.016 |
| Sr-p53 | 0.738 |
| Vol | 383.934 |
| Dense | 0.884 |
| Flex | 3 |
| Nstereo | 5.667 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 0 |
| Qed | 1 |
| Synth | 0.295 |
| Fsp3 | 2.949 |
| Mce-18 | 0.75 |
| Natural product-likeness | 2 |
| Alarm nmr | 1.241 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |