| General Information | |
|---|---|
| ZINC ID | ZINC000013472875 |
| Molecular Weight (Da) | 508 |
| SMILES | Cc1c(C(=O)NN2CCCCC2)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Br)cc1 |
| Molecular Formula | C22Br1Cl2N4O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 125.775 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| LogP | 6.765 |
| Activity (Ki) in nM | 1445.44 |
| Polar Surface Area (PSA) | 50.16 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | + |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.964 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.27 |
| Ilogp | 3.87 |
| Xlogp3 | 6.55 |
| Wlogp | 5.67 |
| Mlogp | 5.18 |
| Silicos-it log p | 5.1 |
| Consensus log p | 5.28 |
| Esol log s | -7.21 |
| Esol solubility (mg/ml) | 0.0000316 |
| Esol solubility (mol/l) | 6.21E-08 |
| Esol class | Poorly sol |
| Ali log s | -7.4 |
| Ali solubility (mg/ml) | 0.0000202 |
| Ali solubility (mol/l) | 3.97E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.45 |
| Silicos-it solubility (mg/ml) | 0.0000018 |
| Silicos-it solubility (mol/l) | 3.53E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.75 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.42 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.334 |
| Logd | 4.752 |
| Logp | 5.657 |
| F (20%) | 0.001 |
| F (30%) | 0.001 |
| Mdck | 7.24E-06 |
| Ppb | 0.9936 |
| Vdss | 0.984 |
| Fu | 0.0182 |
| Cyp1a2-inh | 0.153 |
| Cyp1a2-sub | 0.822 |
| Cyp2c19-inh | 0.903 |
| Cyp2c19-sub | 0.783 |
| Cl | 3.999 |
| T12 | 0.024 |
| H-ht | 0.454 |
| Dili | 0.958 |
| Roa | 0.771 |
| Fdamdd | 0.543 |
| Skinsen | 0.067 |
| Ec | 0.003 |
| Ei | 0.011 |
| Respiratory | 0.679 |
| Bcf | 2.863 |
| Igc50 | 5.076 |
| Lc50 | 6.368 |
| Lc50dm | 6.261 |
| Nr-ar | 0.016 |
| Nr-ar-lbd | 0.007 |
| Nr-ahr | 0.924 |
| Nr-aromatase | 0.925 |
| Nr-er | 0.768 |
| Nr-er-lbd | 0.014 |
| Nr-ppar-gamma | 0.495 |
| Sr-are | 0.888 |
| Sr-atad5 | 0.321 |
| Sr-hse | 0.721 |
| Sr-mmp | 0.95 |
| Sr-p53 | 0.949 |
| Vol | 433.597 |
| Dense | 1.167 |
| Flex | 0.208 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 2 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 1 |
| Qed | 0.467 |
| Synth | 2.48 |
| Fsp3 | 0.273 |
| Mce-18 | 54.214 |
| Natural product-likeness | -1.453 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |