| General Information | |
|---|---|
| ZINC ID | ZINC000013471189 |
| Molecular Weight (Da) | 508 |
| SMILES | Cc1cccc(C)c1N(C(=O)c1ccccc1Cl)C(=O)[C@@H](c1ccc([N+](=O)[O-])cc1)N1CCOCC1 |
| Molecular Formula | C27Cl1N3O5 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 137.952 |
| HBA | 3 |
| HBD | 0 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| LogP | 5.549 |
| Activity (Ki) in nM | 2754.23 |
| Polar Surface Area (PSA) | 92.99 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.948 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.26 |
| Ilogp | 3.17 |
| Xlogp3 | 5.3 |
| Wlogp | 4.41 |
| Mlogp | 2.9 |
| Silicos-it log p | 3.08 |
| Consensus log p | 3.77 |
| Esol log s | -6.17 |
| Esol solubility (mg/ml) | 0.000343 |
| Esol solubility (mol/l) | 0.00000067 |
| Esol class | Poorly sol |
| Ali log s | -7.06 |
| Ali solubility (mg/ml) | 0.0000442 |
| Ali solubility (mol/l) | 8.71E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.48 |
| Silicos-it solubility (mg/ml) | 0.0000167 |
| Silicos-it solubility (mol/l) | 0.00000003 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.64 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 2 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.78 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.871 |
| Logd | 4.196 |
| Logp | 4.084 |
| F (20%) | 0.004 |
| F (30%) | 0.004 |
| Mdck | - |
| Ppb | 97.76% |
| Vdss | 1.148 |
| Fu | 1.45% |
| Cyp1a2-inh | 0.077 |
| Cyp1a2-sub | 0.333 |
| Cyp2c19-inh | 0.877 |
| Cyp2c19-sub | 0.651 |
| Cl | 1.926 |
| T12 | 0.04 |
| H-ht | 0.697 |
| Dili | 0.956 |
| Roa | 0.15 |
| Fdamdd | 0.063 |
| Skinsen | 0.238 |
| Ec | 0.003 |
| Ei | 0.007 |
| Respiratory | 0.044 |
| Bcf | 1.168 |
| Igc50 | 3.09 |
| Lc50 | 4.942 |
| Lc50dm | 4.101 |
| Nr-ar | 0.352 |
| Nr-ar-lbd | 0.038 |
| Nr-ahr | 0.19 |
| Nr-aromatase | 0.955 |
| Nr-er | 0.756 |
| Nr-er-lbd | 0.425 |
| Nr-ppar-gamma | 0.005 |
| Sr-are | 0.752 |
| Sr-atad5 | 0.005 |
| Sr-hse | 0.005 |
| Sr-mmp | 0.801 |
| Sr-p53 | 0.318 |
| Vol | 501.837 |
| Dense | 1.011 |
| Flex | 0.296 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 5 |
| Surechembl | 0 |
| Nonbiodegradable | 4 |
| Skin sensitization | 2 |
| Acute aquatic toxicity | - |
| Toxicophores | 6 |
| Qed | 0.34 |
| Synth | 3.049 |
| Fsp3 | 0.259 |
| Mce-18 | 80.882 |
| Natural product-likeness | -1.419 |
| Alarm nmr | 1 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |