| General Information | |
|---|---|
| ZINC ID | ZINC000009673187 |
| Molecular Weight (Da) | 455 |
| SMILES | Cc1ccc(CNC(=O)c2oc3ccc(S(=O)(=O)N4C[C@@H](C)C[C@H](C)C4)cc3c2C)cc1 |
| Molecular Formula | C25N2O4S1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 123.617 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| LogP | 4.771 |
| Activity (Ki) in nM | 79.4328 |
| Polar Surface Area (PSA) | 88 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.918 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 15 |
| Fraction csp3 | 0.4 |
| Ilogp | 4.26 |
| Xlogp3 | 5.03 |
| Wlogp | 5.19 |
| Mlogp | 2.81 |
| Silicos-it log p | 4.06 |
| Consensus log p | 4.27 |
| Esol log s | -5.78 |
| Esol solubility (mg/ml) | 0.000758 |
| Esol solubility (mol/l) | 0.00000167 |
| Esol class | Moderately |
| Ali log s | -6.62 |
| Ali solubility (mg/ml) | 0.000109 |
| Ali solubility (mol/l) | 0.00000024 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.82 |
| Silicos-it solubility (mg/ml) | 0.00000693 |
| Silicos-it solubility (mol/l) | 1.52E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.5 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.45 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.396 |
| Logd | 4.661 |
| Logp | 5.467 |
| F (20%) | 0.002 |
| F (30%) | 0.003 |
| Mdck | - |
| Ppb | 98.67% |
| Vdss | 0.809 |
| Fu | 2.38% |
| Cyp1a2-inh | 0.508 |
| Cyp1a2-sub | 0.706 |
| Cyp2c19-inh | 0.908 |
| Cyp2c19-sub | 0.705 |
| Cl | 7.735 |
| T12 | 0.04 |
| H-ht | 0.989 |
| Dili | 0.989 |
| Roa | 0.381 |
| Fdamdd | 0.936 |
| Skinsen | 0.069 |
| Ec | 0.003 |
| Ei | 0.011 |
| Respiratory | 0.079 |
| Bcf | 1.439 |
| Igc50 | 4.574 |
| Lc50 | 5.447 |
| Lc50dm | 4.711 |
| Nr-ar | 0.001 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.756 |
| Nr-aromatase | 0.95 |
| Nr-er | 0.132 |
| Nr-er-lbd | 0.004 |
| Nr-ppar-gamma | 0.02 |
| Sr-are | 0.639 |
| Sr-atad5 | 0.004 |
| Sr-hse | 0.032 |
| Sr-mmp | 0.776 |
| Sr-p53 | 0.013 |
| Vol | 461.302 |
| Dense | 0.985 |
| Flex | 0.24 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.609 |
| Synth | 3.034 |
| Fsp3 | 0.4 |
| Mce-18 | 85.429 |
| Natural product-likeness | -1.529 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |