| General Information | |
|---|---|
| ZINC ID | ZINC000009673157 |
| Molecular Weight (Da) | 455 |
| SMILES | Cc1c(C(=O)N(C)Cc2ccccc2)oc2ccc(S(=O)(=O)N3C[C@@H](C)C[C@H](C)C3)cc12 |
| Molecular Formula | C25N2O4S1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 123.472 |
| HBA | 4 |
| HBD | 0 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| LogP | 4.491 |
| Activity (Ki) in nM | 6606.934 |
| Polar Surface Area (PSA) | 79.21 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.071 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 15 |
| Fraction csp3 | 0.4 |
| Ilogp | 3.89 |
| Xlogp3 | 4.84 |
| Wlogp | 5.23 |
| Mlogp | 2.81 |
| Silicos-it log p | 3.48 |
| Consensus log p | 4.05 |
| Esol log s | -5.66 |
| Esol solubility (mg/ml) | 0.000998 |
| Esol solubility (mol/l) | 0.0000022 |
| Esol class | Moderately |
| Ali log s | -6.24 |
| Ali solubility (mg/ml) | 0.000263 |
| Ali solubility (mol/l) | 0.00000057 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.1 |
| Silicos-it solubility (mg/ml) | 0.0000359 |
| Silicos-it solubility (mol/l) | 7.91E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.64 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.45 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.273 |
| Logd | 4.433 |
| Logp | 4.98 |
| F (20%) | 0.01 |
| F (30%) | 0.03 |
| Mdck | 3.65E-05 |
| Ppb | 0.9742 |
| Vdss | 0.725 |
| Fu | 0.0447 |
| Cyp1a2-inh | 0.591 |
| Cyp1a2-sub | 0.875 |
| Cyp2c19-inh | 0.962 |
| Cyp2c19-sub | 0.898 |
| Cl | 8.339 |
| T12 | 0.043 |
| H-ht | 0.989 |
| Dili | 0.991 |
| Roa | 0.263 |
| Fdamdd | 0.907 |
| Skinsen | 0.051 |
| Ec | 0.003 |
| Ei | 0.014 |
| Respiratory | 0.055 |
| Bcf | 1.618 |
| Igc50 | 4.404 |
| Lc50 | 5.27 |
| Lc50dm | 4.178 |
| Nr-ar | 0.001 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.625 |
| Nr-aromatase | 0.934 |
| Nr-er | 0.147 |
| Nr-er-lbd | 0.005 |
| Nr-ppar-gamma | 0.012 |
| Sr-are | 0.594 |
| Sr-atad5 | 0.004 |
| Sr-hse | 0.018 |
| Sr-mmp | 0.769 |
| Sr-p53 | 0.012 |
| Vol | 461.302 |
| Dense | 0.985 |
| Flex | 0.24 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 0.561 |
| Synth | 3.093 |
| Fsp3 | 0.4 |
| Mce-18 | 85.429 |
| Natural product-likeness | -1.557 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |