| General Information | |
|---|---|
| ZINC ID | ZINC000008034993 |
| Molecular Weight (Da) | 326 |
| SMILES | CCCCCCCC/C=CCCCCCCCC(=O)NCCO |
| Molecular Formula | C20N1O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 100.413 |
| HBA | 2 |
| HBD | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| LogP | 5.9 |
| Activity (Ki) in nM | 1096.48 |
| Polar Surface Area (PSA) | 49.33 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | - |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | - |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 0.45624065 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 0 |
| Fraction csp3 | 0.85 |
| Ilogp | 4.42 |
| Xlogp3 | 6.71 |
| Wlogp | 5.13 |
| Mlogp | 3.74 |
| Silicos-it log p | 6.09 |
| Consensus log p | 5.22 |
| Esol log s | -4.9 |
| Esol solubility (mg/ml) | 0.00412 |
| Esol solubility (mol/l) | 0.0000127 |
| Esol class | Moderately |
| Ali log s | -7.55 |
| Ali solubility (mg/ml) | 0.00000917 |
| Ali solubility (mol/l) | 2.82E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -6.24 |
| Silicos-it solubility (mg/ml) | 0.000189 |
| Silicos-it solubility (mol/l) | 0.00000058 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.52 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 1 |
| Egan number of violations | 0 |
| Muegge number of violations | 2 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.04 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.272 |
| Logd | 3.903 |
| Logp | 4.513 |
| F (20%) | 0.966 |
| F (30%) | 0.999 |
| Mdck | - |
| Ppb | 96.36% |
| Vdss | 0.798 |
| Fu | 1.43% |
| Cyp1a2-inh | 0.251 |
| Cyp1a2-sub | 0.292 |
| Cyp2c19-inh | 0.374 |
| Cyp2c19-sub | 0.062 |
| Cl | 6.423 |
| T12 | 0.849 |
| H-ht | 0.08 |
| Dili | 0.021 |
| Roa | 0.028 |
| Fdamdd | 0.016 |
| Skinsen | 0.954 |
| Ec | 0.008 |
| Ei | 0.412 |
| Respiratory | 0.169 |
| Bcf | 0.924 |
| Igc50 | 5.141 |
| Lc50 | 3.54 |
| Lc50dm | 4.319 |
| Nr-ar | 0.009 |
| Nr-ar-lbd | 0.002 |
| Nr-ahr | 0.007 |
| Nr-aromatase | 0.066 |
| Nr-er | 0.281 |
| Nr-er-lbd | 0.006 |
| Nr-ppar-gamma | 0.382 |
| Sr-are | 0.328 |
| Sr-atad5 | 0.006 |
| Sr-hse | 0.835 |
| Sr-mmp | 0.406 |
| Sr-p53 | 0.312 |
| Vol | 377.78 |
| Dense | 0.861 |
| Flex | 9 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.287 |
| Synth | 2.161 |
| Fsp3 | 0.85 |
| Mce-18 | 0 |
| Natural product-likeness | 0.377 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |