| General Information | |
|---|---|
| ZINC ID | ZINC000005820251 |
| Molecular Weight (Da) | 355 |
| SMILES | CCCCCCC(C)(C)c1ccc2c(c1)OC(C)(C)[C@@H]1CC=C(C)C[C@@H]21 |
| Molecular Formula | C25O1 |
| Action | Partial Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 112.977 |
| HBA | 1 |
| HBD | 0 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| LogP | 7.722 |
| Activity (Ki) in nM | 22.9087 |
| Polar Surface Area (PSA) | 9.23 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.122 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.68 |
| Ilogp | 5.02 |
| Xlogp3 | 10.32 |
| Wlogp | 7.55 |
| Mlogp | 5.91 |
| Silicos-it log p | 7.16 |
| Consensus log p | 7.19 |
| Esol log s | -8.31 |
| Esol solubility (mg/ml) | 0.00000172 |
| Esol solubility (mol/l) | 4.85E-09 |
| Esol class | Poorly sol |
| Ali log s | -10.45 |
| Ali solubility (mg/ml) | 1.25E-08 |
| Ali solubility (mol/l) | 3.51E-11 |
| Ali class | Insoluble |
| Silicos-it logsw | -7.71 |
| Silicos-it solubility (mg/ml) | 0.00000695 |
| Silicos-it solubility (mol/l) | 1.96E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -1.14 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 2 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.55 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.005 |
| Logd | 6.294 |
| Logp | 9.546 |
| F (20%) | 0.987 |
| F (30%) | 0.985 |
| Mdck | - |
| Ppb | 100.40% |
| Vdss | 5.353 |
| Fu | 3.32% |
| Cyp1a2-inh | 0.095 |
| Cyp1a2-sub | 0.634 |
| Cyp2c19-inh | 0.516 |
| Cyp2c19-sub | 0.844 |
| Cl | 3.857 |
| T12 | 0.021 |
| H-ht | 0.899 |
| Dili | 0.129 |
| Roa | 0.126 |
| Fdamdd | 0.823 |
| Skinsen | 0.575 |
| Ec | 0.011 |
| Ei | 0.494 |
| Respiratory | 0.059 |
| Bcf | 3.015 |
| Igc50 | 5.376 |
| Lc50 | 6.468 |
| Lc50dm | 6.447 |
| Nr-ar | 0.074 |
| Nr-ar-lbd | 0.005 |
| Nr-ahr | 0.023 |
| Nr-aromatase | 0.689 |
| Nr-er | 0.295 |
| Nr-er-lbd | 0.179 |
| Nr-ppar-gamma | 0.019 |
| Sr-are | 0.414 |
| Sr-atad5 | 0.003 |
| Sr-hse | 0.042 |
| Sr-mmp | 0.778 |
| Sr-p53 | 0.07 |
| Vol | 413.531 |
| Dense | 0.857 |
| Flex | 0.375 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.378 |
| Synth | 3.511 |
| Fsp3 | 0.68 |
| Mce-18 | 68 |
| Natural product-likeness | 1.448 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |