| General Information | |
|---|---|
| ZINC ID | ZINC000003947935 |
| Molecular Weight (Da) | 449 |
| SMILES | O=C(NCC1CCOCC1)c1cnc(Nc2ccc(Cl)c(Cl)c2)nc1C(F)(F)F |
| Molecular Formula | C18Cl2F3N4O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 103.136 |
| HBA | 4 |
| HBD | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| LogP | 4.449 |
| Activity (Ki) in nM | 48.978 |
| Polar Surface Area (PSA) | 76.14 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.84624576 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.39 |
| Ilogp | 3.05 |
| Xlogp3 | 4.13 |
| Wlogp | 5.85 |
| Mlogp | 2.9 |
| Silicos-it log p | 4.49 |
| Consensus log p | 4.08 |
| Esol log s | -5.07 |
| Esol solubility (mg/ml) | 3.81E-03 |
| Esol solubility (mol/l) | 8.48E-06 |
| Esol class | Moderately |
| Ali log s | -5.44 |
| Ali solubility (mg/ml) | 1.65E-03 |
| Ali solubility (mol/l) | 3.67E-06 |
| Ali class | Moderately |
| Silicos-it logsw | -7.52 |
| Silicos-it solubility (mg/ml) | 1.36E-05 |
| Silicos-it solubility (mol/l) | 3.03E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.11 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 2.9 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.147 |
| Logd | 3.811 |
| Logp | 4.231 |
| F (20%) | 0.004 |
| F (30%) | 0.01 |
| Mdck | 2.05E-05 |
| Ppb | 0.9836 |
| Vdss | 1.328 |
| Fu | 0.0193 |
| Cyp1a2-inh | 0.413 |
| Cyp1a2-sub | 0.711 |
| Cyp2c19-inh | 0.935 |
| Cyp2c19-sub | 0.06 |
| Cl | 4.91 |
| T12 | 0.133 |
| H-ht | 0.991 |
| Dili | 0.764 |
| Roa | 0.813 |
| Fdamdd | 0.938 |
| Skinsen | 0.467 |
| Ec | 0.003 |
| Ei | 0.01 |
| Respiratory | 0.929 |
| Bcf | 1.899 |
| Igc50 | 3.972 |
| Lc50 | 5.453 |
| Lc50dm | 6.624 |
| Nr-ar | 0.012 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.938 |
| Nr-aromatase | 0.955 |
| Nr-er | 0.245 |
| Nr-er-lbd | 0.007 |
| Nr-ppar-gamma | 0.063 |
| Sr-are | 0.662 |
| Sr-atad5 | 0.024 |
| Sr-hse | 0.425 |
| Sr-mmp | 0.691 |
| Sr-p53 | 0.683 |
| Vol | 385.952 |
| Dense | 1.161 |
| Flex | 20 |
| Nstereo | 0.3 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 3 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 3 |
| Qed | 1 |
| Synth | 0.737 |
| Fsp3 | 3.052 |
| Mce-18 | 0.389 |
| Natural product-likeness | 48 |
| Alarm nmr | -1.398 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Accepted |
| Goldentriangle | Rejected |