| General Information | |
|---|---|
| ZINC ID | ZINC000002654307 |
| Molecular Weight (Da) | 408 |
| SMILES | O=C(Cc1ccc(Br)cc1)NCCC(c1ccccc1)c1ccccc1 |
| Molecular Formula | C23Br1N1O1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 110.319 |
| HBA | 1 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| LogP | 5.466 |
| Activity (Ki) in nM | 794.328 |
| Polar Surface Area (PSA) | 29.1 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | - |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 1.12075972 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.17 |
| Ilogp | 3.7 |
| Xlogp3 | 5.59 |
| Wlogp | 5.33 |
| Mlogp | 5.2 |
| Silicos-it log p | 6.11 |
| Consensus log p | 5.18 |
| Esol log s | -5.88 |
| Esol solubility (mg/ml) | 0.000541 |
| Esol solubility (mol/l) | 0.00000133 |
| Esol class | Moderately |
| Ali log s | -5.96 |
| Ali solubility (mg/ml) | 0.000445 |
| Ali solubility (mol/l) | 0.00000109 |
| Ali class | Moderately |
| Silicos-it logsw | -9.46 |
| Silicos-it solubility (mg/ml) | 0.00000014 |
| Silicos-it solubility (mol/l) | 3.46E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.82 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 2.37 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.055 |
| Logd | 4.151 |
| Logp | 5.44 |
| F (20%) | 0.589 |
| F (30%) | 0.001 |
| Mdck | - |
| Ppb | 97.99% |
| Vdss | 0.96 |
| Fu | 0.49% |
| Cyp1a2-inh | 0.215 |
| Cyp1a2-sub | 0.617 |
| Cyp2c19-inh | 0.923 |
| Cyp2c19-sub | 0.25 |
| Cl | 3.385 |
| T12 | 0.102 |
| H-ht | 0.299 |
| Dili | 0.705 |
| Roa | 0.205 |
| Fdamdd | 0.528 |
| Skinsen | 0.338 |
| Ec | 0.003 |
| Ei | 0.017 |
| Respiratory | 0.013 |
| Bcf | 1.947 |
| Igc50 | 4.597 |
| Lc50 | 5.356 |
| Lc50dm | 6.204 |
| Nr-ar | 0.457 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.024 |
| Nr-aromatase | 0.009 |
| Nr-er | 0.294 |
| Nr-er-lbd | 0.007 |
| Nr-ppar-gamma | 0.107 |
| Sr-are | 0.105 |
| Sr-atad5 | 0.011 |
| Sr-hse | 0.035 |
| Sr-mmp | 0.487 |
| Sr-p53 | 0.009 |
| Vol | 393.401 |
| Dense | 1.035 |
| Flex | 0.421 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.563 |
| Synth | 1.817 |
| Fsp3 | 0.174 |
| Mce-18 | 15 |
| Natural product-likeness | -0.762 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |