| General Information | |
|---|---|
| ZINC ID | ZINC000002022525 |
| Molecular Weight (Da) | 401 |
| SMILES | CCCCCCC1(c2cc(O)c3c(c2)OC(C)(C)[C@@H]2CC=C(C)C[C@@H]32)OCCO1 |
| Molecular Formula | C25O4 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 116.274 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| LogP | 5.882 |
| Activity (Ki) in nM | 0.2 |
| Polar Surface Area (PSA) | 47.92 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.818 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.68 |
| Ilogp | 4.66 |
| Xlogp3 | 7.1 |
| Wlogp | 6.06 |
| Mlogp | 4.19 |
| Silicos-it log p | 6 |
| Consensus log p | 5.6 |
| Esol log s | -6.55 |
| Esol solubility (mg/ml) | 0.000112 |
| Esol solubility (mol/l) | 0.00000028 |
| Esol class | Poorly sol |
| Ali log s | -7.93 |
| Ali solubility (mg/ml) | 0.00000476 |
| Ali solubility (mol/l) | 1.19E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -6.57 |
| Silicos-it solubility (mg/ml) | 0.000107 |
| Silicos-it solubility (mol/l) | 0.00000026 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.7 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.82 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.447 |
| Logd | 5.321 |
| Logp | 7.996 |
| F (20%) | 0.365 |
| F (30%) | 0.041 |
| Mdck | 2.56E-05 |
| Ppb | 0.9929 |
| Vdss | 3.953 |
| Fu | 0.0098 |
| Cyp1a2-inh | 0.073 |
| Cyp1a2-sub | 0.561 |
| Cyp2c19-inh | 0.814 |
| Cyp2c19-sub | 0.738 |
| Cl | 3.911 |
| T12 | 0.08 |
| H-ht | 0.847 |
| Dili | 0.048 |
| Roa | 0.226 |
| Fdamdd | 0.897 |
| Skinsen | 0.662 |
| Ec | 0.003 |
| Ei | 0.073 |
| Respiratory | 0.551 |
| Bcf | 2.279 |
| Igc50 | 5.006 |
| Lc50 | 6.003 |
| Lc50dm | 6.214 |
| Nr-ar | 0.012 |
| Nr-ar-lbd | 0.005 |
| Nr-ahr | 0.656 |
| Nr-aromatase | 0.889 |
| Nr-er | 0.258 |
| Nr-er-lbd | 0.553 |
| Nr-ppar-gamma | 0.417 |
| Sr-are | 0.76 |
| Sr-atad5 | 0.011 |
| Sr-hse | 0.179 |
| Sr-mmp | 0.948 |
| Sr-p53 | 0.601 |
| Vol | 431.345 |
| Dense | 0.928 |
| Flex | 0.286 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 2 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 0.458 |
| Synth | 3.91 |
| Fsp3 | 0.68 |
| Mce-18 | 84.524 |
| Natural product-likeness | 1.866 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |